CAS 1027101-94-5 appears in our catalog under these names: (4R)-4-Methyl-D-proline hydrochloride, (2R,4R)-4-methylpyrrolidine-2-carboxylic acid hydrochloride, 95%, 95%, H-cis-4-Me-D-Pro-OH HCl, 95%. Offered by: Biosynth, Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1000mg, 1g.
(2R,4R)-4-methylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 1027101-94-5) is a chemical compound with the molecular formula C6H12ClNO2 and a molecular weight of 165.62 g/mol. IUPAC name: (2R,4R)-4-methylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: VLDINRBTKBFNDD-TYSVMGFPSA-N.
| Molecular formula | C6H12ClNO2 |
|---|---|
| Molecular weight | 165.62 g/mol |
| IUPAC name | (2R,4R)-4-methylpyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | VLDINRBTKBFNDD-TYSVMGFPSA-N |
| SMILES | C[C@@H]1C[C@@H](NC1)C(=O)O.Cl |
Computed by PubChem (NCBI)