CAS 201481-62-1 appears in our catalog under these names: (2S,4S)-4-Methylpyrrolidine-2-carboxylic acid monohydrochloride, 97%, (4S)-4-Methyl-L-proline hydrochloride, H-cis-4-Me-Pro-OH HCl 97%, (2S,4S)-4-Methylpyrrolidine-2-carboxylic acid monohydrochloride, 97%, 97%, (4S)-4-METHYL-L-PROLINE HCL, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 1g, 100mg, 250mg, 5g.
(2S,4S)-4-methylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 201481-62-1) is a chemical compound with the molecular formula C6H12ClNO2 and a molecular weight of 165.62 g/mol. IUPAC name: (2S,4S)-4-methylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: VLDINRBTKBFNDD-FHAQVOQBSA-N.
| Molecular formula | C6H12ClNO2 |
|---|---|
| Molecular weight | 165.62 g/mol |
| IUPAC name | (2S,4S)-4-methylpyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | VLDINRBTKBFNDD-FHAQVOQBSA-N |
| SMILES | C[C@H]1C[C@H](NC1)C(=O)O.Cl |
Computed by PubChem (NCBI)