Products 1027330-97-7
CAS 1027330-97-7 appears in our catalog under these names: A 943931, A-943931, 99.57%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 2mg, 1 mg, 5 mg, 10 mg.
6-[(3R)-3-aminopyrrolidin-1-yl]-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-4-amine (CAS 1027330-97-7) is a chemical compound with the molecular formula C17H21N5 and a molecular weight of 295.4 g/mol. IUPAC name: 6-[(3R)-3-aminopyrrolidin-1-yl]-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-4-amine. InChIKey: SDTRYHWIXVHTLM-GFCCVEGCSA-N.
| Molecular formula | C17H21N5 |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | 6-[(3R)-3-aminopyrrolidin-1-yl]-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-4-amine |
| InChIKey | SDTRYHWIXVHTLM-GFCCVEGCSA-N |
| SMILES | C1CC2=CC=CC=C2C3=C(C1)C(=NC(=N3)N)N4CC[C@H](C4)N |
Computed by PubChem (NCBI)