CAS 381208-40-8 appears in our catalog under these names: 2-[4-(Diethylamino)phenyl]-6-methyl-2h-1,2,3-benzotriazol-5-amine, 95%, ART-CHEM-BB B025267, 2-[4-(diethylamino)phenyl]-6-methyl-2H-1,2,3-benzotriazol-5-amine, Utrophin activator-1. Offered by: Combi-blocks, TargetMol, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-amine (CAS 381208-40-8) is a chemical compound with the molecular formula C17H21N5 and a molecular weight of 295.4 g/mol. IUPAC name: 2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-amine. InChIKey: WRIPKYOZKAJHRL-UHFFFAOYSA-N.
| Molecular formula | C17H21N5 |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | 2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-amine |
| InChIKey | WRIPKYOZKAJHRL-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)N2N=C3C=C(C(=CC3=N2)N)C |
Computed by PubChem (NCBI)