Products 2538293-52-4
CAS 2538293-52-4 is the registry number for BI-9466. Offered by: MedChemExpress. Available pack sizes: Get quote.
[3,5-dimethyl-4-[1-methyl-5-(3-methylimidazol-4-yl)imidazol-4-yl]phenyl]methanamine (CAS 2538293-52-4) is a chemical compound with the molecular formula C17H21N5 and a molecular weight of 295.4 g/mol. IUPAC name: [3,5-dimethyl-4-[1-methyl-5-(3-methylimidazol-4-yl)imidazol-4-yl]phenyl]methanamine. InChIKey: SFZHMKDAVPIXRB-UHFFFAOYSA-N.
| Molecular formula | C17H21N5 |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | [3,5-dimethyl-4-[1-methyl-5-(3-methylimidazol-4-yl)imidazol-4-yl]phenyl]methanamine |
| InChIKey | SFZHMKDAVPIXRB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C2=C(N(C=N2)C)C3=CN=CN3C)C)CN |
Computed by PubChem (NCBI)