CAS 138682-26-5 is the registry number for 2,6-Bis((3,5-dimethyl-1H-pyrazol-1-yl)methyl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine (CAS 138682-26-5) is a chemical compound with the molecular formula C17H21N5 and a molecular weight of 295.4 g/mol. IUPAC name: 2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine. InChIKey: PZROUOOSVHHWDV-UHFFFAOYSA-N.
| Molecular formula | C17H21N5 |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | 2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine |
| InChIKey | PZROUOOSVHHWDV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CC2=NC(=CC=C2)CN3C(=CC(=N3)C)C)C |
Computed by PubChem (NCBI)