CAS 1027513-36-5 is the registry number for 4-Methoxycarbonyl-2-fluorophenylisothiocyanate, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g.
Methyl 3-fluoro-4-isothiocyanatobenzoate (CAS 1027513-36-5) is a chemical compound with the molecular formula C9H6FNO2S and a molecular weight of 211.21 g/mol. IUPAC name: methyl 3-fluoro-4-isothiocyanatobenzoate. InChIKey: OFQYGASRCYMAOF-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2S |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | methyl 3-fluoro-4-isothiocyanatobenzoate |
| InChIKey | OFQYGASRCYMAOF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)N=C=S)F |
Computed by PubChem (NCBI)