CAS 1934467-56-7 is the registry number for Isoquinoline-6-sulfonyl fluoride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Isoquinoline-6-sulfonyl fluoride (CAS 1934467-56-7) is a chemical compound with the molecular formula C9H6FNO2S and a molecular weight of 211.21 g/mol. IUPAC name: isoquinoline-6-sulfonyl fluoride. InChIKey: OPTGZNFRKOIQSE-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2S |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | isoquinoline-6-sulfonyl fluoride |
| InChIKey | OPTGZNFRKOIQSE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2)C=C1S(=O)(=O)F |
Computed by PubChem (NCBI)