Products 1027514-24-4
CAS 1027514-24-4 is the registry number for (3,4-Dimethoxyphenyl)(difluoro)acetic acid, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
2-(3,4-dimethoxyphenyl)-2,2-difluoroacetic acid (CAS 1027514-24-4) is a chemical compound with the molecular formula C10H10F2O4 and a molecular weight of 232.18 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-2,2-difluoroacetic acid. InChIKey: YYYODAOLDZONQG-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O4 |
|---|---|
| Molecular weight | 232.18 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-2,2-difluoroacetic acid |
| InChIKey | YYYODAOLDZONQG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(C(=O)O)(F)F)OC |
Computed by PubChem (NCBI)