Products 1780120-99-1

CAS 1780120-99-1 is the registry number for 3-(2,5-Difluoro-4-methoxyphenyl)-2-hydroxypropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(2,5-difluoro-4-methoxyphenyl)-2-hydroxypropanoic acid (CAS 1780120-99-1) is a chemical compound with the molecular formula C10H10F2O4 and a molecular weight of 232.18 g/mol. IUPAC name: 3-(2,5-difluoro-4-methoxyphenyl)-2-hydroxypropanoic acid. InChIKey: LGUXQOSTNCUJRC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10F2O4
Molecular weight232.18 g/mol
IUPAC name3-(2,5-difluoro-4-methoxyphenyl)-2-hydroxypropanoic acid
InChIKeyLGUXQOSTNCUJRC-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)F)CC(C(=O)O)O)F

Computed by PubChem (NCBI)