CAS 1780120-99-1 is the registry number for 3-(2,5-Difluoro-4-methoxyphenyl)-2-hydroxypropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,5-difluoro-4-methoxyphenyl)-2-hydroxypropanoic acid (CAS 1780120-99-1) is a chemical compound with the molecular formula C10H10F2O4 and a molecular weight of 232.18 g/mol. IUPAC name: 3-(2,5-difluoro-4-methoxyphenyl)-2-hydroxypropanoic acid. InChIKey: LGUXQOSTNCUJRC-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O4 |
|---|---|
| Molecular weight | 232.18 g/mol |
| IUPAC name | 3-(2,5-difluoro-4-methoxyphenyl)-2-hydroxypropanoic acid |
| InChIKey | LGUXQOSTNCUJRC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)F)CC(C(=O)O)O)F |
Computed by PubChem (NCBI)