Products 2407068-27-1

CAS 2407068-27-1 is the registry number for 4-(Dimethoxymethyl)-2,3-difluorobenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-(dimethoxymethyl)-2,3-difluorobenzoic acid (CAS 2407068-27-1) is a chemical compound with the molecular formula C10H10F2O4 and a molecular weight of 232.18 g/mol. IUPAC name: 4-(dimethoxymethyl)-2,3-difluorobenzoic acid. InChIKey: OIVPMOWGKKRIAL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10F2O4
Molecular weight232.18 g/mol
IUPAC name4-(dimethoxymethyl)-2,3-difluorobenzoic acid
InChIKeyOIVPMOWGKKRIAL-UHFFFAOYSA-N
SMILESCOC(C1=C(C(=C(C=C1)C(=O)O)F)F)OC

Computed by PubChem (NCBI)