CAS 2407068-27-1 is the registry number for 4-(Dimethoxymethyl)-2,3-difluorobenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-(dimethoxymethyl)-2,3-difluorobenzoic acid (CAS 2407068-27-1) is a chemical compound with the molecular formula C10H10F2O4 and a molecular weight of 232.18 g/mol. IUPAC name: 4-(dimethoxymethyl)-2,3-difluorobenzoic acid. InChIKey: OIVPMOWGKKRIAL-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O4 |
|---|---|
| Molecular weight | 232.18 g/mol |
| IUPAC name | 4-(dimethoxymethyl)-2,3-difluorobenzoic acid |
| InChIKey | OIVPMOWGKKRIAL-UHFFFAOYSA-N |
| SMILES | COC(C1=C(C(=C(C=C1)C(=O)O)F)F)OC |
Computed by PubChem (NCBI)