Products 501435-61-6

CAS 501435-61-6 is the registry number for 3,3-Difluoro-2-hydroxy-3-(4-methoxyphenyl)propionic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3,3-difluoro-2-hydroxy-3-(4-methoxyphenyl)propanoic acid (CAS 501435-61-6) is a chemical compound with the molecular formula C10H10F2O4 and a molecular weight of 232.18 g/mol. IUPAC name: 3,3-difluoro-2-hydroxy-3-(4-methoxyphenyl)propanoic acid. InChIKey: ILHZBDNSEQAZCX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10F2O4
Molecular weight232.18 g/mol
IUPAC name3,3-difluoro-2-hydroxy-3-(4-methoxyphenyl)propanoic acid
InChIKeyILHZBDNSEQAZCX-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C(C(C(=O)O)O)(F)F

Computed by PubChem (NCBI)