CAS 1190314-69-2 appears in our catalog under these names: Methyl 5-fluoro-7-azaindole-3-carboxylate, 98%, 98%, 5-FLUORO-7-AZAINDOLE-3-CARBOXYLIC ACID METHYL ESTER, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 2g.
Methyl 5-fluoro-1H-pyrrolo[2,3-b]pyridine-3-carboxylate (CAS 1190314-69-2) is a chemical compound with the molecular formula C9H7FN2O2 and a molecular weight of 194.16 g/mol. IUPAC name: methyl 5-fluoro-1H-pyrrolo[2,3-b]pyridine-3-carboxylate. InChIKey: SDFAOMSNGRJZID-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O2 |
|---|---|
| Molecular weight | 194.16 g/mol |
| IUPAC name | methyl 5-fluoro-1H-pyrrolo[2,3-b]pyridine-3-carboxylate |
| InChIKey | SDFAOMSNGRJZID-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CNC2=C1C=C(C=N2)F |
Computed by PubChem (NCBI)