Products 102778-42-7
CAS 102778-42-7 is the registry number for (1S,2S)-2-Phenylcyclopentan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
Cis-(1S,2S)-2-phenylcyclopentan-1-amine;hydrochloride (CAS 102778-42-7) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: cis-(1S,2S)-2-phenylcyclopentan-1-amine;hydrochloride. InChIKey: FWIIHEJLRNKGDU-ACMTZBLWSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | cis-(1S,2S)-2-phenylcyclopentan-1-amine;hydrochloride |
| InChIKey | FWIIHEJLRNKGDU-ACMTZBLWSA-N |
| SMILES | C1C[C@H]([C@H](C1)N)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)