Products 5588-23-8
CAS 5588-23-8 appears in our catalog under these names: Cypenamine (hydrochloride), Cypenamine (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg, 1 mg.
2-phenylcyclopentan-1-amine;hydrochloride (CAS 5588-23-8) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: 2-phenylcyclopentan-1-amine;hydrochloride. InChIKey: FWIIHEJLRNKGDU-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | 2-phenylcyclopentan-1-amine;hydrochloride |
| InChIKey | FWIIHEJLRNKGDU-UHFFFAOYSA-N |
| SMILES | C1CC(C(C1)N)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)
Synonyms:
CYPENAMINE HYDROCHLORIDE, Cypenamine HCl, Cypenamine hydrochloride [USAN], 2-Phenylcyclopentylamine hydrochloride, Cyclopentanamine, 2-phenyl-, hydrochloride, Cyclopentylamine, 2-phenyl-, hydrochloride, Cypenamine hydrochloride (USAN), Cypenamine (hydrochloride), 2-phenylcyclopentan-1-amine hydrochloride, 2-phenylcyclopentan-1-amine;hydrochloride