Products 10287-54-4
CAS 10287-54-4 appears in our catalog under these names: ethyl 4–diethylaminobenzoate, Ethyl 4-(diethylamino)benzoate, 97%, Ethyl 4-(N,N-diethylamino)benzoate, Ethyl 4-(n,n-diethylamino)benzoate, 95%, Ethyl 4-(N,N-diethylamino)benzoate, min. 95 %, 2 g. Offered by: GLPBio, AmBeed, Biosynth, Combi-blocks, Roth. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 50g, 2g.
Ethyl 4-(diethylamino)benzoate (CAS 10287-54-4) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: ethyl 4-(diethylamino)benzoate. InChIKey: XPKFLEVLLPKCIW-UHFFFAOYSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | ethyl 4-(diethylamino)benzoate |
| InChIKey | XPKFLEVLLPKCIW-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)C(=O)OCC |
Computed by PubChem (NCBI)
Synonyms:
ethyl 4-(diethylamino)benzoate, Ethyl 4-diethylaminobenzoate, ethyl 4-diEtAB, Ethyl p-(diethylamino)benzoate, ETHYL p-DIETHYLAMINOBENZOATE, ethyl p-(N,N-diethylamino)benzoate, p-(Diethylamino)benzoic acid ethyl ester, Benzoic acid,4-(diethylamino)-, ethyl ester, Benzoic acid, 4-(diethylamino)-, ethyl ester, Benzoic acid, p-(diethylamino)-, ethyl ester