Products 59862-86-1
CAS 59862-86-1 is the registry number for tert-Butyl 5-nitrofuran-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 5-nitrofuran-2-carboxylate (CAS 59862-86-1) is a chemical compound with the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. IUPAC name: tert-butyl 5-nitrofuran-2-carboxylate. InChIKey: WNMYFKYXNKXPFH-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | tert-butyl 5-nitrofuran-2-carboxylate |
| InChIKey | WNMYFKYXNKXPFH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(O1)[N+](=O)[O-] |
Computed by PubChem (NCBI)