Products 1028752-24-0
CAS 1028752-24-0 is the registry number for tert-Butyl 6-cyano-1H-pyrrolo(2,3-b)pyridine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg, 5000mg.
Tert-butyl 6-cyanopyrrolo[2,3-b]pyridine-1-carboxylate (CAS 1028752-24-0) is a chemical compound with the molecular formula C13H13N3O2 and a molecular weight of 243.26 g/mol. IUPAC name: tert-butyl 6-cyanopyrrolo[2,3-b]pyridine-1-carboxylate. InChIKey: MCQXNMBDBCEVIP-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O2 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | tert-butyl 6-cyanopyrrolo[2,3-b]pyridine-1-carboxylate |
| InChIKey | MCQXNMBDBCEVIP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C1N=C(C=C2)C#N |
Computed by PubChem (NCBI)