Products 4703-38-2
CAS 4703-38-2 appears in our catalog under these names: 2-Benzamido-4-(methylthio)butanoic acid, 2-Benzamido-4-(methylthio)butanoic acid, 95%, 2-Benzamido-4-(methylthio)butanoic acid, 95%, 95%, Benzoyl-DL-methionine, >99.0%(T). Offered by: MedChemExpress, Fluorochem, Chemat, TCI. Available pack sizes: 1 g, 250 mg, 10 g, 5 g, 25g, 1g, 5g, 10g.
2-benzamido-4-methylsulfanylbutanoic acid (CAS 4703-38-2) is a chemical compound with the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. IUPAC name: 2-benzamido-4-methylsulfanylbutanoic acid. InChIKey: PPFRJEXUPZWQPI-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | 2-benzamido-4-methylsulfanylbutanoic acid |
| InChIKey | PPFRJEXUPZWQPI-UHFFFAOYSA-N |
| SMILES | CSCCC(C(=O)O)NC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)
Synonyms:
Benzoyl-dl-methionine, N-Benzoyl-dl-methionine, 2-Benzamido-4-(methylthio)butanoic acid, Benzoylmethionine, 2-benzamido-4-methylsulfanylbutanoic acid, N-benzoylmethionine, 4-(methylsulfanyl)-2-(phenylformamido)butanoic acid, Bz-DL-Met-OH, 4-methylthio-2-(phenylcarbonylamino)butanoic acid, Bzo-DL-Met-OH