CAS 102991-38-8 appears in our catalog under these names: 2,3,4,9–tetrahydro–1H–pyrido(3,4–b)indole–1–carboxylic acid, 2,3,4,9-Tetrahydro-1H-b-carboline-1-carboxylic acid, ≥97%, ≥97%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 500mg, 50mg, 250mg.
2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxylic acid (CAS 102991-38-8) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxylic acid. InChIKey: XGCIVVYTCDKDLC-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxylic acid |
| InChIKey | XGCIVVYTCDKDLC-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=C1C3=CC=CC=C3N2)C(=O)O |
Computed by PubChem (NCBI)