CAS 6649-91-8 appears in our catalog under these names: 1,2,3,4-Tetrahydro-beta-carboline-1-carboxylic acid, 95%, 1,2,3,4-Tetrahydro-ß-carboline-1-carboxylic Acid, >95% (HPLC), 1,2,3,4–Tetrahydro–β–carboline–1–carboxylic acid, 1,2,3,4-Tetrahydro-β-carboline-1-carboxylic acid, 1,2,3,4-Tetrahydro-β-carboline-1-carboxylic acid, 99.47%. Offered by: Combi-blocks, TRC, GLPBio, TargetMol, MedChemExpress. Available pack sizes: 500mg, 5g, 10mg, 25mg, 500 mg, 50 mg, 10mM/1mL, 100 mg.
2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxylic acid (CAS 6649-91-8) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxylic acid. InChIKey: XGCIVVYTCDKDLC-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxylic acid |
| InChIKey | XGCIVVYTCDKDLC-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=C1C3=CC=CC=C3N2)C(=O)O |
Computed by PubChem (NCBI)