Products 1280651-36-6

CAS 1280651-36-6 is the registry number for 3-(1-Methyl-1H-pyrrole-2-carboxamido)tetrahydrothiophene-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[(1-methylpyrrole-2-carbonyl)amino]thiolane-3-carboxylic acid (CAS 1280651-36-6) is a chemical compound with the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. IUPAC name: 3-[(1-methylpyrrole-2-carbonyl)amino]thiolane-3-carboxylic acid. InChIKey: FUYDKIANTIKTBF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14N2O3S
Molecular weight254.31 g/mol
IUPAC name3-[(1-methylpyrrole-2-carbonyl)amino]thiolane-3-carboxylic acid
InChIKeyFUYDKIANTIKTBF-UHFFFAOYSA-N
SMILESCN1C=CC=C1C(=O)NC2(CCSC2)C(=O)O

Computed by PubChem (NCBI)