CAS 103038-66-0 appears in our catalog under these names: 3-Chloro-n-(2-chlorobenzyl)propanamide, 95%, 3-Chloro-N-(2-chlorobenzyl)propanamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g.
3-chloro-N-[(2-chlorophenyl)methyl]propanamide (CAS 103038-66-0) is a chemical compound with the molecular formula C10H11Cl2NO and a molecular weight of 232.10 g/mol. IUPAC name: 3-chloro-N-[(2-chlorophenyl)methyl]propanamide. InChIKey: UDCPSNFIOXHTMT-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO |
|---|---|
| Molecular weight | 232.10 g/mol |
| IUPAC name | 3-chloro-N-[(2-chlorophenyl)methyl]propanamide |
| InChIKey | UDCPSNFIOXHTMT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC(=O)CCCl)Cl |
Computed by PubChem (NCBI)