CAS 1030420-83-7 is the registry number for 2-Pyridin-4-yl[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-pyridin-4-yl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (CAS 1030420-83-7) is a chemical compound with the molecular formula C9H7N7 and a molecular weight of 213.20 g/mol. IUPAC name: 2-pyridin-4-yl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine. InChIKey: ZEPSRLVNIZCFLA-UHFFFAOYSA-N.
| Molecular formula | C9H7N7 |
|---|---|
| Molecular weight | 213.20 g/mol |
| IUPAC name | 2-pyridin-4-yl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| InChIKey | ZEPSRLVNIZCFLA-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=NN3C(=NC=NC3=N2)N |
Computed by PubChem (NCBI)