CAS 1423810-54-1 appears in our catalog under these names: 2H–Tetrazole,5–(4–(1H–1,2,4–triazol–1–yl)phenyl), 5-(4-(1H-1,2,4-Triazol-1-yl)phenyl)-2H-tetrazole, 97%, 97%, 5-[4-(1H-1,2,4-triazol-1-yl)phenyl]-1H-1,2,3,4-tetrazole. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
5-[4-(1,2,4-triazol-1-yl)phenyl]-2H-tetrazole (CAS 1423810-54-1) is a chemical compound with the molecular formula C9H7N7 and a molecular weight of 213.20 g/mol. IUPAC name: 5-[4-(1,2,4-triazol-1-yl)phenyl]-2H-tetrazole. InChIKey: ZHDMYGJRWUULQP-UHFFFAOYSA-N.
| Molecular formula | C9H7N7 |
|---|---|
| Molecular weight | 213.20 g/mol |
| IUPAC name | 5-[4-(1,2,4-triazol-1-yl)phenyl]-2H-tetrazole |
| InChIKey | ZHDMYGJRWUULQP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNN=N2)N3C=NC=N3 |
Computed by PubChem (NCBI)