CAS 39242-18-7 appears in our catalog under these names: 2,6–Di(1H–1,2,4–triazol–1–yl)pyridine, 2,6-Di(1H-1,2,4-triazol-1-yl)pyridine, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2,6-bis(1,2,4-triazol-1-yl)pyridine (CAS 39242-18-7) is a chemical compound with the molecular formula C9H7N7 and a molecular weight of 213.20 g/mol. IUPAC name: 2,6-bis(1,2,4-triazol-1-yl)pyridine. InChIKey: MFOIBUMMJBNCGI-UHFFFAOYSA-N.
| Molecular formula | C9H7N7 |
|---|---|
| Molecular weight | 213.20 g/mol |
| IUPAC name | 2,6-bis(1,2,4-triazol-1-yl)pyridine |
| InChIKey | MFOIBUMMJBNCGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)N2C=NC=N2)N3C=NC=N3 |
Computed by PubChem (NCBI)