CAS 856849-59-7 is the registry number for 2,6-Di(4H-1,2,4-triazol-4-yl)pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,6-bis(1,2,4-triazol-4-yl)pyridine (CAS 856849-59-7) is a chemical compound with the molecular formula C9H7N7 and a molecular weight of 213.20 g/mol. IUPAC name: 2,6-bis(1,2,4-triazol-4-yl)pyridine. InChIKey: COCYNXXKOTVJJO-UHFFFAOYSA-N.
| Molecular formula | C9H7N7 |
|---|---|
| Molecular weight | 213.20 g/mol |
| IUPAC name | 2,6-bis(1,2,4-triazol-4-yl)pyridine |
| InChIKey | COCYNXXKOTVJJO-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)N2C=NN=C2)N3C=NN=C3 |
Computed by PubChem (NCBI)