CAS 1030457-06-7 is the registry number for 8-(4-Chlorophenyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
8-(4-chlorophenyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine (CAS 1030457-06-7) is a chemical compound with the molecular formula C11H8ClN5 and a molecular weight of 245.67 g/mol. IUPAC name: 8-(4-chlorophenyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine. InChIKey: KBTKYYMAFMYCNV-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN5 |
|---|---|
| Molecular weight | 245.67 g/mol |
| IUPAC name | 8-(4-chlorophenyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine |
| InChIKey | KBTKYYMAFMYCNV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C3N=CN=C(N3N=C2)N)Cl |
Computed by PubChem (NCBI)