CAS 6289-04-9 is the registry number for 1-(4-Chlorophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS 6289-04-9) is a chemical compound with the molecular formula C11H8ClN5 and a molecular weight of 245.67 g/mol. IUPAC name: 1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: NTRNCDBHKIJOLA-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN5 |
|---|---|
| Molecular weight | 245.67 g/mol |
| IUPAC name | 1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | NTRNCDBHKIJOLA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C3=NC=NC(=C3C=N2)N)Cl |
Computed by PubChem (NCBI)