CAS 21410-06-0 appears in our catalog under these names: 3-Benzyl-7-chloro-3h-[1,2,3]-triazolo[4,5-d]pyrimidine, 95%, 3-Benzyl-7-chloro-3H-(1,2,3)triazolo(4,5-d)pyrimidine, 98%, 3-Benzyl-7-chloro-3H-[1,2,3]-triazolo[4,5-d]pyriMidine, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
3-benzyl-7-chlorotriazolo[4,5-d]pyrimidine (CAS 21410-06-0) is a chemical compound with the molecular formula C11H8ClN5 and a molecular weight of 245.67 g/mol. IUPAC name: 3-benzyl-7-chlorotriazolo[4,5-d]pyrimidine. InChIKey: KVYUVZPCMWVWAU-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN5 |
|---|---|
| Molecular weight | 245.67 g/mol |
| IUPAC name | 3-benzyl-7-chlorotriazolo[4,5-d]pyrimidine |
| InChIKey | KVYUVZPCMWVWAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C(=NC=N3)Cl)N=N2 |
Computed by PubChem (NCBI)