CAS 1352319-13-1 is the registry number for 6-Chloro-1-(pyridin-3-ylmethyl)-1H-pyrazolo[3,4-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-1-(pyridin-3-ylmethyl)pyrazolo[3,4-d]pyrimidine (CAS 1352319-13-1) is a chemical compound with the molecular formula C11H8ClN5 and a molecular weight of 245.67 g/mol. IUPAC name: 6-chloro-1-(pyridin-3-ylmethyl)pyrazolo[3,4-d]pyrimidine. InChIKey: LZEYROSDZZUCGK-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN5 |
|---|---|
| Molecular weight | 245.67 g/mol |
| IUPAC name | 6-chloro-1-(pyridin-3-ylmethyl)pyrazolo[3,4-d]pyrimidine |
| InChIKey | LZEYROSDZZUCGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CN2C3=NC(=NC=C3C=N2)Cl |
Computed by PubChem (NCBI)