CAS 1030620-57-5 appears in our catalog under these names: 1',3'-Dimethyl-1'H,2H-[3,4'-bipyrazole]-5-carboxylic acid, 97%, 5-(1,3-Dimethyl-1H-pyrazol-4-yl)-1H-pyrazole-3-carboxylic acid. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 2,5g, 250mg.
3-(1,3-dimethylpyrazol-4-yl)-1H-pyrazole-5-carboxylic acid (CAS 1030620-57-5) is a chemical compound with the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. IUPAC name: 3-(1,3-dimethylpyrazol-4-yl)-1H-pyrazole-5-carboxylic acid. InChIKey: YVDRJBGUCMZMDC-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O2 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | 3-(1,3-dimethylpyrazol-4-yl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | YVDRJBGUCMZMDC-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1C2=NNC(=C2)C(=O)O)C |
Computed by PubChem (NCBI)