CAS 10311-33-8 appears in our catalog under these names: 3-Acetamido-2,4-dimethylbenzenesulfonyl chloride, 95%, 3-Acetamido-2,4-dimethylbenzenesulfonyl chloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
3-acetamido-2,4-dimethylbenzenesulfonyl chloride (CAS 10311-33-8) is a chemical compound with the molecular formula C10H12ClNO3S and a molecular weight of 261.73 g/mol. IUPAC name: 3-acetamido-2,4-dimethylbenzenesulfonyl chloride. InChIKey: SELBURDMPHBZRW-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO3S |
|---|---|
| Molecular weight | 261.73 g/mol |
| IUPAC name | 3-acetamido-2,4-dimethylbenzenesulfonyl chloride |
| InChIKey | SELBURDMPHBZRW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)S(=O)(=O)Cl)C)NC(=O)C |
Computed by PubChem (NCBI)