Products 952959-47-6

CAS 952959-47-6 appears in our catalog under these names: 2-Acetamido-5-ethylbenzenesulfonyl chloride, 95%, 2-Acetamido-5-ethylbenzene-1-sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-acetamido-5-ethylbenzenesulfonyl chloride (CAS 952959-47-6) is a chemical compound with the molecular formula C10H12ClNO3S and a molecular weight of 261.73 g/mol. IUPAC name: 2-acetamido-5-ethylbenzenesulfonyl chloride. InChIKey: KUXZLAXOUBDPOK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12ClNO3S
Molecular weight261.73 g/mol
IUPAC name2-acetamido-5-ethylbenzenesulfonyl chloride
InChIKeyKUXZLAXOUBDPOK-UHFFFAOYSA-N
SMILESCCC1=CC(=C(C=C1)NC(=O)C)S(=O)(=O)Cl

Computed by PubChem (NCBI)