CAS 952959-47-6 appears in our catalog under these names: 2-Acetamido-5-ethylbenzenesulfonyl chloride, 95%, 2-Acetamido-5-ethylbenzene-1-sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
2-acetamido-5-ethylbenzenesulfonyl chloride (CAS 952959-47-6) is a chemical compound with the molecular formula C10H12ClNO3S and a molecular weight of 261.73 g/mol. IUPAC name: 2-acetamido-5-ethylbenzenesulfonyl chloride. InChIKey: KUXZLAXOUBDPOK-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO3S |
|---|---|
| Molecular weight | 261.73 g/mol |
| IUPAC name | 2-acetamido-5-ethylbenzenesulfonyl chloride |
| InChIKey | KUXZLAXOUBDPOK-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C=C1)NC(=O)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)