CAS 2712741-58-5 is the registry number for 4,6,7,8-Tetrahydro-5,8-ethanofuro[3,2-c]azepine-2-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-oxa-8-azatricyclo[6.2.2.02,6]dodeca-2(6),4-diene-4-sulfonyl chloride (CAS 2712741-58-5) is a chemical compound with the molecular formula C10H12ClNO3S and a molecular weight of 261.73 g/mol. IUPAC name: 3-oxa-8-azatricyclo[6.2.2.02,6]dodeca-2(6),4-diene-4-sulfonyl chloride. InChIKey: WNHNURGEXGOLRK-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO3S |
|---|---|
| Molecular weight | 261.73 g/mol |
| IUPAC name | 3-oxa-8-azatricyclo[6.2.2.02,6]dodeca-2(6),4-diene-4-sulfonyl chloride |
| InChIKey | WNHNURGEXGOLRK-UHFFFAOYSA-N |
| SMILES | C1CN2CCC1C3=C(C2)C=C(O3)S(=O)(=O)Cl |
Computed by PubChem (NCBI)