CAS 669747-36-8 is the registry number for Ethyl 2-[(chloroacetyl)amino]-5-methylthiophene-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Ethyl 2-[(2-chloroacetyl)amino]-5-methylthiophene-3-carboxylate (CAS 669747-36-8) is a chemical compound with the molecular formula C10H12ClNO3S and a molecular weight of 261.73 g/mol. IUPAC name: ethyl 2-[(2-chloroacetyl)amino]-5-methylthiophene-3-carboxylate. InChIKey: LICKHIGCRDZQHR-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO3S |
|---|---|
| Molecular weight | 261.73 g/mol |
| IUPAC name | ethyl 2-[(2-chloroacetyl)amino]-5-methylthiophene-3-carboxylate |
| InChIKey | LICKHIGCRDZQHR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1)C)NC(=O)CCl |
Computed by PubChem (NCBI)