CAS 1031417-71-6 appears in our catalog under these names: 5–Bromo–3,7–dimethyl–1H–indazole, 5-Bromo-3,7-dimethyl-1H-indazole, 97%, 97%, 5-BROMO-3,7-DIMETHYL-1H-INDAZOLE, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 50mg, 5g.
5-bromo-3,7-dimethyl-2H-indazole (CAS 1031417-71-6) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 5-bromo-3,7-dimethyl-2H-indazole. InChIKey: XQNOSHGIULZYET-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2 |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 5-bromo-3,7-dimethyl-2H-indazole |
| InChIKey | XQNOSHGIULZYET-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C(NN=C12)C)Br |
Computed by PubChem (NCBI)