CAS 1031794-72-5 is the registry number for 5-(2,4-Dichlorophenyl)-1H-pyrazole-4-carbaldehyde. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-(2,4-dichlorophenyl)-1H-pyrazole-4-carbaldehyde (CAS 1031794-72-5) is a chemical compound with the molecular formula C10H6Cl2N2O and a molecular weight of 241.07 g/mol. IUPAC name: 5-(2,4-dichlorophenyl)-1H-pyrazole-4-carbaldehyde. InChIKey: DPDNYLPQPBRRBB-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O |
|---|---|
| Molecular weight | 241.07 g/mol |
| IUPAC name | 5-(2,4-dichlorophenyl)-1H-pyrazole-4-carbaldehyde |
| InChIKey | DPDNYLPQPBRRBB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=C(C=NN2)C=O |
Computed by PubChem (NCBI)