Products 1820704-50-4
CAS 1820704-50-4 is the registry number for 3-Chloro-1-(3-chloropyridin-4-yl)pyridin-4-one, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 100g, 5g.
3-chloro-1-(3-chloro-4-pyridinyl)pyridin-4-one (CAS 1820704-50-4) is a chemical compound with the molecular formula C10H6Cl2N2O and a molecular weight of 241.07 g/mol. IUPAC name: 3-chloro-1-(3-chloro-4-pyridinyl)pyridin-4-one. InChIKey: KXSNQLWTBMVSNM-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O |
|---|---|
| Molecular weight | 241.07 g/mol |
| IUPAC name | 3-chloro-1-(3-chloro-4-pyridinyl)pyridin-4-one |
| InChIKey | KXSNQLWTBMVSNM-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1N2C=CC(=O)C(=C2)Cl)Cl |
Computed by PubChem (NCBI)