CAS 1540484-01-2 is the registry number for 2-(2,4-Dichlorophenyl)-1H-imidazole-5-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4-dichlorophenyl)-1H-imidazole-5-carbaldehyde (CAS 1540484-01-2) is a chemical compound with the molecular formula C10H6Cl2N2O and a molecular weight of 241.07 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-1H-imidazole-5-carbaldehyde. InChIKey: AMDNYPIUZXCAIX-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O |
|---|---|
| Molecular weight | 241.07 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-1H-imidazole-5-carbaldehyde |
| InChIKey | AMDNYPIUZXCAIX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=NC=C(N2)C=O |
Computed by PubChem (NCBI)