CAS 1032039-17-0 is the registry number for (1,1-Dioxidotetrahydrothiophen-3-yl)-L-proline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-1-(1,1-dioxothiolan-3-yl)pyrrolidine-2-carboxylic acid (CAS 1032039-17-0) is a chemical compound with the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. IUPAC name: (2S)-1-(1,1-dioxothiolan-3-yl)pyrrolidine-2-carboxylic acid. InChIKey: JRTXZCHACQZANY-MQWKRIRWSA-N.
| Molecular formula | C9H15NO4S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | (2S)-1-(1,1-dioxothiolan-3-yl)pyrrolidine-2-carboxylic acid |
| InChIKey | JRTXZCHACQZANY-MQWKRIRWSA-N |
| SMILES | C1C[C@H](N(C1)C2CCS(=O)(=O)C2)C(=O)O |
Computed by PubChem (NCBI)