CAS 2604488-91-5 is the registry number for N-((2,2-Dimethyl-1,3-dioxolan-4-yl)methyl)-N-ethynylmethanesulfonamide, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-N-ethynylmethanesulfonamide (CAS 2604488-91-5) is a chemical compound with the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. IUPAC name: N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-N-ethynylmethanesulfonamide. InChIKey: XQFNLEGXSBGQJQ-UHFFFAOYSA-N.
| Molecular formula | C9H15NO4S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-N-ethynylmethanesulfonamide |
| InChIKey | XQFNLEGXSBGQJQ-UHFFFAOYSA-N |
| SMILES | CC1(OCC(O1)CN(C#C)S(=O)(=O)C)C |
Computed by PubChem (NCBI)