CAS 1704271-84-0 is the registry number for 4-((1,1-Dioxidotetrahydro-2H-thiopyran-4-yl)amino)but-2-enoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-4-[(1,1-dioxothian-4-yl)amino]but-2-enoic acid (CAS 1704271-84-0) is a chemical compound with the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. IUPAC name: (E)-4-[(1,1-dioxothian-4-yl)amino]but-2-enoic acid. InChIKey: OITINTPGURFPFL-OWOJBTEDSA-N.
| Molecular formula | C9H15NO4S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | (E)-4-[(1,1-dioxothian-4-yl)amino]but-2-enoic acid |
| InChIKey | OITINTPGURFPFL-OWOJBTEDSA-N |
| SMILES | C1CS(=O)(=O)CCC1NC/C=C/C(=O)O |
Computed by PubChem (NCBI)