CAS 1396964-43-4 is the registry number for (1,1-Dioxido-2,3-dihydrothiophen-3-yl)valine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-3-methylbutanoic acid (CAS 1396964-43-4) is a chemical compound with the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. IUPAC name: 2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-3-methylbutanoic acid. InChIKey: XKRRWBGVNOXMOZ-UHFFFAOYSA-N.
| Molecular formula | C9H15NO4S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | 2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-3-methylbutanoic acid |
| InChIKey | XKRRWBGVNOXMOZ-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)NC1CS(=O)(=O)C=C1 |
Computed by PubChem (NCBI)