CAS 1032273-54-3 is the registry number for 4-Bromo-4,4-difluoro-1-phenyl-1,3-butanedione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-bromo-4,4-difluoro-1-phenylbutane-1,3-dione (CAS 1032273-54-3) is a chemical compound with the molecular formula C10H7BrF2O2 and a molecular weight of 277.06 g/mol. IUPAC name: 4-bromo-4,4-difluoro-1-phenylbutane-1,3-dione. InChIKey: GLCNHCGZVUHBQG-UHFFFAOYSA-N.
| Molecular formula | C10H7BrF2O2 |
|---|---|
| Molecular weight | 277.06 g/mol |
| IUPAC name | 4-bromo-4,4-difluoro-1-phenylbutane-1,3-dione |
| InChIKey | GLCNHCGZVUHBQG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC(=O)C(F)(F)Br |
Computed by PubChem (NCBI)