CAS 371967-22-5 is the registry number for 1-(4-Bromo-phenyl)-4,4-difluorobutane-1,3-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(4-bromophenyl)-4,4-difluorobutane-1,3-dione (CAS 371967-22-5) is a chemical compound with the molecular formula C10H7BrF2O2 and a molecular weight of 277.06 g/mol. IUPAC name: 1-(4-bromophenyl)-4,4-difluorobutane-1,3-dione. InChIKey: LCAVLPVFVYDVTM-UHFFFAOYSA-N.
| Molecular formula | C10H7BrF2O2 |
|---|---|
| Molecular weight | 277.06 g/mol |
| IUPAC name | 1-(4-bromophenyl)-4,4-difluorobutane-1,3-dione |
| InChIKey | LCAVLPVFVYDVTM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC(=O)C(F)F)Br |
Computed by PubChem (NCBI)