Products 2098048-73-6
CAS 2098048-73-6 appears in our catalog under these names: 3–(4–bromophenyl)–2，2–difluorocyclopropane–1–carboxylic acid, 3-(4-bromophenyl)-2，2-difluorocyclopropane-1-carboxylic acid, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g.
3-(4-bromophenyl)-2,2-difluorocyclopropane-1-carboxylic acid (CAS 2098048-73-6) is a chemical compound with the molecular formula C10H7BrF2O2 and a molecular weight of 277.06 g/mol. IUPAC name: 3-(4-bromophenyl)-2,2-difluorocyclopropane-1-carboxylic acid. InChIKey: GYKLECAKZLVRBQ-UHFFFAOYSA-N.
| Molecular formula | C10H7BrF2O2 |
|---|---|
| Molecular weight | 277.06 g/mol |
| IUPAC name | 3-(4-bromophenyl)-2,2-difluorocyclopropane-1-carboxylic acid |
| InChIKey | GYKLECAKZLVRBQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2C(C2(F)F)C(=O)O)Br |
Computed by PubChem (NCBI)