Products 2228693-15-8

CAS 2228693-15-8 is the registry number for 1-(3-Bromophenyl)-2,2-difluorocyclopropane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-(3-bromophenyl)-2,2-difluorocyclopropane-1-carboxylic acid (CAS 2228693-15-8) is a chemical compound with the molecular formula C10H7BrF2O2 and a molecular weight of 277.06 g/mol. IUPAC name: 1-(3-bromophenyl)-2,2-difluorocyclopropane-1-carboxylic acid. InChIKey: MHGFBZRQYKCJIT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7BrF2O2
Molecular weight277.06 g/mol
IUPAC name1-(3-bromophenyl)-2,2-difluorocyclopropane-1-carboxylic acid
InChIKeyMHGFBZRQYKCJIT-UHFFFAOYSA-N
SMILESC1C(C1(F)F)(C2=CC(=CC=C2)Br)C(=O)O

Computed by PubChem (NCBI)