CAS 103321-51-3 is the registry number for Fmoc-L-Isoleucyl chloride 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
9H-fluoren-9-ylmethyl N-[(2S,3S)-1-chloro-3-methyl-1-oxopentan-2-yl]carbamate (CAS 103321-51-3) is a chemical compound with the molecular formula C21H22ClNO3 and a molecular weight of 371.9 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(2S,3S)-1-chloro-3-methyl-1-oxopentan-2-yl]carbamate. InChIKey: UBXQQZYYSMFLLM-DJJJIMSYSA-N.
| Molecular formula | C21H22ClNO3 |
|---|---|
| Molecular weight | 371.9 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(2S,3S)-1-chloro-3-methyl-1-oxopentan-2-yl]carbamate |
| InChIKey | UBXQQZYYSMFLLM-DJJJIMSYSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)Cl)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)