CAS 10333-68-3 appears in our catalog under these names: 2-(Pyrrol-1-yl)benzoic acid, 98%, 2-(1H-Pyrrol-1-yl)benzoic acid, 98%, 2-(1-Pyrrolyl)benzoic acid, 99% , 2-(1H-Pyrrol-1-yl)benzoic acid. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 10g, 1g, 25g, 5g, 5mg, 25mg.
2-pyrrol-1-ylbenzoic acid (CAS 10333-68-3) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 2-pyrrol-1-ylbenzoic acid. InChIKey: GNWTWXOZRSBCOZ-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 2-pyrrol-1-ylbenzoic acid |
| InChIKey | GNWTWXOZRSBCOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)N2C=CC=C2 |
Computed by PubChem (NCBI)